152502-85-7 Usage
Uses
Used in Anticancer Applications:
1-(2-deoxy-2-C-fluoromethylarabinofuranosyl)cytosine is used as an anticancer agent for its potential to treat various solid tumors. Its unique mechanism of action, which involves inhibiting DNA replication, makes it a promising candidate for combination therapies with other chemotherapeutic drugs, potentially enhancing the overall treatment efficacy.
Used in Research and Diagnostic Applications:
In the field of research and diagnostics, 1-(2-deoxy-2-C-fluoromethylarabinofuranosyl)cytosine is used as a probe for detecting DNA synthesis and replication. Its ability to inhibit DNA replication and its resistance to degradation make it a valuable tool for studying cellular processes and developing diagnostic tests for various conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 152502-85-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,2,5,0 and 2 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 152502-85:
(8*1)+(7*5)+(6*2)+(5*5)+(4*0)+(3*2)+(2*8)+(1*5)=107
107 % 10 = 7
So 152502-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H14FN3O4/c11-3-5-8(16)6(4-15)18-9(5)14-2-1-7(12)13-10(14)17/h1-2,5-6,8-9,15-16H,3-4H2,(H2,12,13,17)/t5-,6+,8-,9?/m0/s1
