153034-83-4 Usage
Uses
Used in Organic Synthesis:
2-Fluoro-3,4-diiodopyridine serves as a key building block in organic synthesis, utilized for the creation of a wide array of organic compounds. Its presence of fluorine and iodine atoms allows for diverse chemical reactions, facilitating the synthesis of complex organic molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-Fluoro-3,4-diiodopyridine is employed as a valuable reagent in drug discovery. Its unique structure contributes to the development of new chemical entities with potential therapeutic applications, enhancing the discovery of novel pharmaceuticals.
Used in the Development of New Materials:
2-Fluoro-3,4-diiodopyridine's distinctive chemical properties also make it a candidate for the development of new materials. Its potential use in material science could lead to advancements in various fields, including electronics, polymers, and other high-tech applications.
Used in Agrochemicals:
2-Fluoro-3,4-diiodopyridine has potential applications in the agrochemical sector, where it could be utilized in the development of new pesticides or herbicides. Its unique structure may contribute to the creation of more effective and environmentally friendly agrochemicals.
Used in Drug Discovery:
2-Fluoro-3,4-diiodopyridine is also a significant player in drug discovery, where it aids in the design and synthesis of new pharmaceutical compounds. Its presence in the molecular structure can influence the pharmacokinetics and pharmacodynamics of potential drugs, leading to innovative treatments for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 153034-83-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,3,0,3 and 4 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 153034-83:
(8*1)+(7*5)+(6*3)+(5*0)+(4*3)+(3*4)+(2*8)+(1*3)=104
104 % 10 = 4
So 153034-83-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H2FI2N/c6-5-4(8)3(7)1-2-9-5/h1-2H
