153435-68-8 Usage
General Description
5-Bromo-N-methyl-nicotinamide is a chemical compound that is derived from nicotinamide, which is a form of vitamin B3. It is also known as 5-Bromo-3-methylpyridine-4-carboxylic acid amide. 5-Bromo-N-methyl-nicotinamide is commonly used in pharmaceutical research and drug development due to its potential as a building block for creating new drugs. It has been studied for its potential in treating neurological disorders, cancer, and other diseases. Additionally, it has been used as a reactant in organic synthesis to create other compounds with potential pharmacological activity. Overall, 5-Bromo-N-methyl-nicotinamide is a valuable chemical in the field of medicinal chemistry and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 153435-68-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,3,4,3 and 5 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 153435-68:
(8*1)+(7*5)+(6*3)+(5*4)+(4*3)+(3*5)+(2*6)+(1*8)=128
128 % 10 = 8
So 153435-68-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H7BrN2O/c1-9-7(11)5-2-6(8)4-10-3-5/h2-4H,1H3,(H,9,11)
