153435-68-8 Usage
Uses
Used in Pharmaceutical Research and Drug Development:
5-Bromo-N-methyl-nicotinamide is used as a building block for creating new drugs due to its potential in treating neurological disorders, cancer, and other diseases. Its unique structure and properties make it a promising candidate for the development of innovative therapeutic agents.
Used in Neurological Disorder Treatment:
In the field of neurology, 5-Bromo-N-methyl-nicotinamide is used as a potential therapeutic agent for treating neurological disorders. Its ability to modulate specific pathways and targets associated with these conditions makes it a valuable compound for research and development in this area.
Used in Cancer Treatment:
5-Bromo-N-methyl-nicotinamide is also used as a potential anticancer agent, with studies exploring its effects on various types of cancer. Its ability to target and modulate specific cellular processes involved in cancer progression makes it a promising candidate for cancer therapy.
Used in Organic Synthesis:
In the realm of organic synthesis, 5-Bromo-N-methyl-nicotinamide serves as a reactant for creating other compounds with potential pharmacological activity. Its unique chemical properties allow for the synthesis of novel compounds that can be further explored for their therapeutic potential.
Overall, 5-Bromo-N-methyl-nicotinamide is a versatile and valuable chemical compound with a wide range of applications in the pharmaceutical and medicinal chemistry industries. Its potential in drug development, treatment of neurological disorders, cancer therapy, and organic synthesis highlights its importance and relevance in the ongoing pursuit of new and effective therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 153435-68-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,3,4,3 and 5 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 153435-68:
(8*1)+(7*5)+(6*3)+(5*4)+(4*3)+(3*5)+(2*6)+(1*8)=128
128 % 10 = 8
So 153435-68-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H7BrN2O/c1-9-7(11)5-2-6(8)4-10-3-5/h2-4H,1H3,(H,9,11)
