15397-51-0 Usage
Molecular structure
A complex structure containing a purine base, oxolane ring, and hydroxymethyl and methylsulfanyl groups.
Classification
A nucleoside analog.
Purine base
A nitrogen-containing heterocyclic aromatic organic compound that forms the building block of nucleic acids.
Oxolane ring
A five-membered cyclic ether with two oxygen atoms and three carbon atoms, contributing to the compound's ring structure.
Hydroxymethyl group
A functional group consisting of a hydroxyl group (-OH) attached to a methyl group (-CH3), contributing to the compound's polarity and solubility.
Methylsulfanyl group
A sulfur-containing alkyl group (-SCH3) that imparts unique chemical properties and reactivity to the compound.
Potential applications
Antiviral and anticancer agent.
Inhibits viral replication
The compound can interfere with the replication process of viruses, potentially serving as an antiviral agent.
Inhibits tumor cell growth
The compound may hinder the growth and proliferation of cancer cells, making it a potential anticancer agent.
Relevance in drug development and medicinal chemistry
The compound's unique structure and potential therapeutic applications make it a promising candidate for further research and development in the field of drug design and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 15397-51-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,3,9 and 7 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 15397-51:
(7*1)+(6*5)+(5*3)+(4*9)+(3*7)+(2*5)+(1*1)=120
120 % 10 = 0
So 15397-51-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N4O4S/c1-20-10-6-9(12-3-13-10)15(4-14-6)11-8(18)7(17)5(2-16)19-11/h3-5,7-8,11,16-18H,2H2,1H3
