154203-99-3 Usage
Uses
Used in Flavoring Industry:
5-Thiazolecarboxylic Acid, 4-Methyl-, Ethyl Ester is used as a flavoring agent for its ability to impart specific taste characteristics to food products. Its use in this industry is primarily due to its unique aromatic properties that can enhance the flavor profile of various consumables.
Used in Chemical Research:
In addition to its practical applications, 5-Thiazolecarboxylic Acid, 4-Methyl-, Ethyl Ester is also utilized in chemical research as a synthetic compound. It serves as a building block or intermediate in the synthesis of more complex molecules, contributing to the development of new materials and compounds with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 154203-99-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,4,2,0 and 3 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 154203-99:
(8*1)+(7*5)+(6*4)+(5*2)+(4*0)+(3*3)+(2*9)+(1*9)=113
113 % 10 = 3
So 154203-99-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H12O2S/c1-3-11-9(10)6-8-7(2)4-5-12-8/h4-5H,3,6H2,1-2H3
