15421-37-1 Usage
Chemical class
Belongs to the class of phenothiazine derivatives.
Structure
Consists of a phenothiazinium cation with a dimethylammonium propyl group attached to the nitrogen atom.
Anionic component
Contains a hydrogen phosphate anion.
Redox activity
Acts as a redox-active molecule.
Applications
Widely used as a redox indicator and a photosensitizer in various chemical and biological applications.
Therapeutic potential
Studied for its potential therapeutic properties, including inhibition of cancer cell growth, anti-inflammatory, and antimicrobial activities.
Fluorescence properties
Exhibits fluorescence, making it useful in fluorescence microscopy and related imaging techniques.
Solubility
Generally soluble in water and polar solvents due to the presence of the hydrogen phosphate anion.
Stability
Relatively stable under normal conditions, but sensitive to light and heat, which can affect its fluorescence properties and redox activity.
Check Digit Verification of cas no
The CAS Registry Mumber 15421-37-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,4,2 and 1 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 15421-37:
(7*1)+(6*5)+(5*4)+(4*2)+(3*1)+(2*3)+(1*7)=81
81 % 10 = 1
So 15421-37-1 is a valid CAS Registry Number.
InChI:InChI=1/C17H20N2S.H3O4P/c1-18(2)12-7-13-19-14-8-3-5-10-16(14)20-17-11-6-4-9-15(17)19;1-5(2,3)4/h3-6,8-11H,7,12-13H2,1-2H3;(H3,1,2,3,4)/p-1
