154592-20-8 Usage
Description
Copper pyrithione is a chemical compound that possesses antifungal and antibacterial properties. It is commonly used as an additive in various industries due to its ability to prevent the growth of microorganisms and protect materials from biofouling.
Uses
Used in Marine and Submarine Textile Material Industry:
Copper pyrithione is used as an antifouling agent for marine or submarine textile materials to inhibit biofouling. The application reason is that it effectively prevents the growth of microorganisms, such as algae, fungi, and bacteria, which can attach to and damage these materials, leading to reduced performance and increased maintenance costs. By incorporating copper pyrithione, the longevity and functionality of marine and submarine textiles are significantly improved.
Check Digit Verification of cas no
The CAS Registry Mumber 154592-20-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,4,5,9 and 2 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 154592-20:
(8*1)+(7*5)+(6*4)+(5*5)+(4*9)+(3*2)+(2*2)+(1*0)=138
138 % 10 = 8
So 154592-20-8 is a valid CAS Registry Number.
InChI:InChI=1/C5H5NOS.Cu/c7-6-4-2-1-3-5(6)8;/h1-4,7H;/q;+2