154676-70-7Relevant academic research and scientific papers
Synthesis and characterization of a stable iron(II) hydride-thiolate complex: (PhS)Fe(H)(CO)2(P(OPh)3)2
Wander, Sheryl A.,Reibenspies, Joseph H.,Kim, Jang Sub,Darensbourg, Marcetta Y.
, p. 1421 - 1426 (2008/10/08)
The anionic, bis(phosphite)iron hydride complex [Et4N][HFe(CO)2(P(OPh)3)2] reacts with aryl disulfides to yield simple, monofunctional iron thiolate anions, (ArS)Fe(CO)2(P(OPh)3)2- (Ar = Ph, Tol). Methylation of the thiolates resulted in the formation of thioether species (ArSMe)Fe(CO)2(P(OPh)3)2, while protonation resulted in the formation of the stable thiolate-hydride complexes (ArS)Fe(H)(CO)2(P(OPh)3)2. cct-(PhS)Fe(H)(CO)2(P(OPh)3)2 was characterized by X-ray diffraction and found to be a regular octahedral complex in which the phosphite ligands are trans and the carbonyls cis, mutually trans to the hydride and benzenethiolate ligands. The hydride was located 1.41(7) ? from Fe with ∠H-Fe-S = 89(4)°. (PhS)Fe(H)(CO)2(P(OPh)3)2 crystallized in the monoclinic space group P21/n with a = 9.935(2) ?, b = 36.185(5) ?, c = 12.112(2) ?, β = 113.42(1)°, V = 3995.5(0) ?,3 and Z = 4. (PhS)Fe(H)(CO)2(P(OPh)3)2 was protonated to form the novel thiol-hydride complex (PhSH)Fe(H)(CO)2(P(OPh)3)2+.
