154932-75-9 Usage
Uses
Used in Research Applications:
2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-5-ol is used as a research chemical for its unique structure, which allows scientists to study its interactions with other molecules and its potential applications in various chemical and biological processes.
Used in Pharmaceutical Applications:
In the pharmaceutical industry, 2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-5-ol is used as a precursor or intermediate in the synthesis of pharmaceutical compounds. Its specific role in drug development may vary, but its unique structure suggests it could be involved in the creation of new drugs targeting various diseases and conditions.
Used in Organic Synthesis:
2-(pyridin-4-ylmethyl)-2,3-dihydro-1H-inden-5-ol is used as a building block in organic synthesis for creating complex organic compounds. Its pyridine and indenol moieties provide opportunities for further chemical reactions and modifications, expanding the range of possible applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 154932-75-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,4,9,3 and 2 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 154932-75:
(8*1)+(7*5)+(6*4)+(5*9)+(4*3)+(3*2)+(2*7)+(1*5)=149
149 % 10 = 9
So 154932-75-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H15NO/c17-15-2-1-13-8-12(9-14(13)10-15)7-11-3-5-16-6-4-11/h1-6,10,12,17H,7-9H2
