155272-00-7 Usage
Purine ring structure
The compound contains a purine ring, which is a heterocyclic aromatic organic compound consisting of a pyrimidine ring fused to an imidazole ring.
Derivative of caffeine
The compound is a modified version of caffeine, which is a naturally occurring stimulant found in coffee, tea, and other beverages.
Diethyl group
The compound has two ethyl groups (C2H5) attached to the purine ring, which increases its molecular weight and alters its chemical properties.
Benzo dioxol-5-yl group
The compound has a benzo dioxole ring (a six-membered aromatic ring with two oxygen atoms) attached to the purine ring, which contributes to its complexity and potential pharmacological activity.
Double bond in the ethenyl group
The compound has a double bond (C=C) in the ethenyl group (a two-carbon group with a double bond) attached to the benzo dioxole ring, which increases its reactivity and potential for further chemical modification.
(E)conformation
The compound has a (E)conformation, which refers to the geometry of the double bond in the ethenyl group. This conformation affects the compound's physical and chemical properties.
Synthetic compound
The compound is not found naturally and is synthesized in a laboratory.
Potential pharmaceutical applications
The compound has potential as a pharmaceutical agent, but further research is needed to determine its specific uses and effects.
Check Digit Verification of cas no
The CAS Registry Mumber 155272-00-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,5,2,7 and 2 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 155272-00:
(8*1)+(7*5)+(6*5)+(5*2)+(4*7)+(3*2)+(2*0)+(1*0)=117
117 % 10 = 7
So 155272-00-7 is a valid CAS Registry Number.
InChI:InChI=1/C20H22N4O5/c1-5-23-18-16(19(25)24(6-2)20(23)26)22(3)15(21-18)8-7-12-9-13(27-4)17-14(10-12)28-11-29-17/h7-10H,5-6,11H2,1-4H3/b8-7+