155272-07-4 Usage
General Description
(E)-8-(4-(4-bromobutoxy)styryl)-1,3-diethyl-7-methylxanthine is a chemical compound with a complex structure consisting of a xanthine base with a styryl group attached to it through a butoxy linker. The compound also contains bromine, ethyl, and methyl functional groups. It is a derivative of caffeine and is often used in research and pharmaceutical applications. The compound is known for its potential as a therapeutic agent in various medical conditions, including neurological disorders, cancer, and metabolic diseases. Its unique structure and properties make it a valuable tool for studying the biological effects of caffeine and related xanthine derivatives in the human body.
Check Digit Verification of cas no
The CAS Registry Mumber 155272-07-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,5,2,7 and 2 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 155272-07:
(8*1)+(7*5)+(6*5)+(5*2)+(4*7)+(3*2)+(2*0)+(1*7)=124
124 % 10 = 4
So 155272-07-4 is a valid CAS Registry Number.
InChI:InChI=1/C22H27BrN4O3/c1-4-26-20-19(21(28)27(5-2)22(26)29)25(3)18(24-20)13-10-16-8-11-17(12-9-16)30-15-7-6-14-23/h8-13H,4-7,14-15H2,1-3H3/b13-10+