15535-93-0 Usage
Uses
Used in Pharmaceutical Production:
2-Aminoacetamidine is used as an intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the formation of complex organic molecules that are integral to drug development.
Used in Chemical Synthesis:
As a reagent, 2-Aminoacetamidine is utilized in chemical synthesis processes, facilitating the creation of a wide range of organic compounds that are essential in different industries.
Used in Medical Research:
2-Aminoacetamidine is employed as a research compound in medical studies, potentially contributing to the discovery of new therapeutic agents and advancing understanding in organic chemistry related to medicine.
Used in Organic Chemistry Development:
In the field of organic chemistry, 2-Aminoacetamidine is used as a building block for the development of new complex organic molecules, showcasing its importance in the synthesis of innovative chemical structures.
Check Digit Verification of cas no
The CAS Registry Mumber 15535-93-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,5,3 and 5 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 15535-93:
(7*1)+(6*5)+(5*5)+(4*3)+(3*5)+(2*9)+(1*3)=110
110 % 10 = 0
So 15535-93-0 is a valid CAS Registry Number.
InChI:InChI=1/C3H8N4/c4-2(5)1-3(6)7/h1H2,(H3,4,5)(H3,6,7)
