15540-82-6 Usage
Appearance
Yellow crystalline solid The compound has a yellow color and a crystalline structure.
Solubility
Insoluble in water, soluble in organic solvents It does not dissolve well in water but can dissolve in certain organic solvents, such as ethanol or acetone.
Primary use
Intermediate in synthesis 2,3-Dibromo-5-nitro-p-xylene is mainly used as an intermediate in the production of pharmaceuticals, dyes, and other organic compounds.
Application
Reagent in organic chemistry reactions The compound is also used as a reagent in organic chemistry reactions, particularly for the synthesis of aromatic compounds.
Hazardous substance
Potential health and environmental risks 2,3-Dibromo-5-nitro-p-xylene is considered hazardous, and proper handling and safety precautions should be taken to minimize potential risks to human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 15540-82-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,5,4 and 0 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 15540-82:
(7*1)+(6*5)+(5*5)+(4*4)+(3*0)+(2*8)+(1*2)=96
96 % 10 = 6
So 15540-82-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H7Br2NO2/c1-4-3-6(11(12)13)5(2)8(10)7(4)9/h3H,1-2H3
