1555-11-9 Usage
Uses
Used in Medicinal Chemistry:
2-FLUORO-7,8,9,10-TETRAHYDRO-6H-CYCLOHEPTA[B]QUINOLINE-11-CARBOXYLIC ACID is used as a chemical intermediate for the synthesis of various pharmaceutical compounds due to its unique structure and functional groups.
Used in Drug Development:
2-FLUORO-7,8,9,10-TETRAHYDRO-6H-CYCLOHEPTA[B]QUINOLINE-11-CARBOXYLIC ACID is used as a potential drug candidate for the development of new therapeutic agents, particularly in the treatment of various diseases and disorders. Its unique structure and the presence of the fluorine atom may enhance its bioavailability and pharmacokinetic properties, leading to improved therapeutic effects.
Used in Pharmaceutical Industry:
2-FLUORO-7,8,9,10-TETRAHYDRO-6H-CYCLOHEPTA[B]QUINOLINE-11-CARBOXYLIC ACID is used as a key component in the formulation of pharmaceutical products, leveraging its unique chemical properties and potential therapeutic benefits.
Used in Research and Development:
2-FLUORO-7,8,9,10-TETRAHYDRO-6H-CYCLOHEPTA[B]QUINOLINE-11-CARBOXYLIC ACID is used as a subject of research and development in the field of chemistry and biology, aiming to understand its potential applications, properties, and mechanisms of action. Further studies may reveal its potential as a novel therapeutic agent or a valuable chemical intermediate in the synthesis of other bioactive compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 1555-11-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,5 and 5 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 1555-11:
(6*1)+(5*5)+(4*5)+(3*5)+(2*1)+(1*1)=69
69 % 10 = 9
So 1555-11-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H14FNO2/c16-9-6-7-13-11(8-9)14(15(18)19)10-4-2-1-3-5-12(10)17-13/h6-8H,1-5H2,(H,18,19)
