155613-98-2 Usage
Description
1-BUTYL-2-[2-[3-[(1-BUTYL-6-CHLOROBENZ[CD]INDOL-2(1H)-YLIDENE)ETHYLIDENE]-2-CHLORO-1-CYCLOHEXEN-1-YL]ETHENYL]-6-CHLOROBENZ[CD]INDOLIUM TETRAFLUOROBORATE is a complex organic chemical compound characterized by a long and intricate molecular structure. It is composed of multiple carbon and hydrogen atoms, along with chlorine and boron atoms. 1-BUTYL-2-[2-[3-[(1-BUTYL-6-CHLOROBENZ[CD]INDOL-2(1H)-YLIDENE)ETHYLIDENE]-2-CHLORO-1-CYCLOHEXEN-1-YL]ETHENYL]-6-CHLOROBENZ[CD]INDOLIUM TETRAFLUOROBORATE's complexity and specific structure suggest that it may possess unique chemical properties and potential applications in various fields, such as chemistry and materials science. However, further research and analysis are required to fully understand its behavior and explore its possible uses.
Uses
As the provided materials do not specify any particular applications for 1-BUTYL-2-[2-[3-[(1-BUTYL-6-CHLOROBENZ[CD]INDOL-2(1H)-YLIDENE)ETHYLIDENE]-2-CHLORO-1-CYCLOHEXEN-1-YL]ETHENYL]-6-CHLOROBENZ[CD]INDOLIUM TETRAFLUOROBORATE, it is not possible to list its uses based on the given information. However, given its complex structure and composition, it is likely that this compound could have potential applications in various industries, such as pharmaceuticals, materials science, or chemical research. Further investigation and experimentation would be necessary to determine its specific uses and benefits in these fields.
Check Digit Verification of cas no
The CAS Registry Mumber 155613-98-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,5,6,1 and 3 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 155613-98:
(8*1)+(7*5)+(6*5)+(5*6)+(4*1)+(3*3)+(2*9)+(1*8)=142
142 % 10 = 2
So 155613-98-2 is a valid CAS Registry Number.
InChI:InChI=1/C40H38Cl3N2.BF4/c1-3-5-24-44-34(30-14-8-12-28-32(41)18-22-36(44)38(28)30)20-16-26-10-7-11-27(40(26)43)17-21-35-31-15-9-13-29-33(42)19-23-37(39(29)31)45(35)25-6-4-2;2-1(3,4)5/h8-9,12-23H,3-7,10-11,24-25H2,1-2H3;/q+1;-1