15572-02-8 Usage
General Description
4-(4-chloro-2-methoxyphenyl)-4-oxobutyric acid is a chemical compound with the molecular formula C11H11ClO4. It is a derivative of phenyl-4-butanone and belongs to the class of phenolic ketones. 4-(4-CHLORO-2-METHOXYPHENYL)-4-OXOBUTYRIC ACID is commonly used as an intermediate in the production of various pharmaceuticals and as a reagent in chemical synthesis. It has also been studied for its potential antioxidant and antimicrobial properties. Additionally, it is known to be a substrate for enzymes involved in the metabolism of xenobiotics in the liver. Overall, 4-(4-chloro-2-methoxyphenyl)-4-oxobutyric acid has several industrial and research applications due to its chemical reactivity and potential biological activity.
Check Digit Verification of cas no
The CAS Registry Mumber 15572-02-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,5,7 and 2 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 15572-02:
(7*1)+(6*5)+(5*5)+(4*7)+(3*2)+(2*0)+(1*2)=98
98 % 10 = 8
So 15572-02-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H11ClO4/c1-16-10-6-7(12)2-3-8(10)9(13)4-5-11(14)15/h2-3,6H,4-5H2,1H3,(H,14,15)