155735-02-7 Usage
General Description
6-Chloro-imidazo[1,2-a]pyridine-8-carboxylic acid is a synthetic chemical compound that is used in the pharmaceutical industry for the development of new drugs. It is a heterocyclic compound containing a chlorine atom and a carboxylic acid functional group. The presence of the imidazo[1,2-a]pyridine ring makes it a potent pharmacophore for the development of various therapeutic agents. 6-CHLORO-IMIDAZO[1,2-A]PYRIDINE-8-CARBOXYLIC ACID has potential applications in the treatment of various diseases such as cancer, inflammation, and infectious diseases. Its unique chemical structure and properties make it a valuable building block for the synthesis of novel drug candidates with improved pharmacological properties. Further research and development of this compound may lead to the discovery of new therapeutic agents with enhanced biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 155735-02-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,5,7,3 and 5 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 155735-02:
(8*1)+(7*5)+(6*5)+(5*7)+(4*3)+(3*5)+(2*0)+(1*2)=137
137 % 10 = 7
So 155735-02-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H5ClN2O2/c9-5-3-6(8(12)13)7-10-1-2-11(7)4-5/h1-4H,(H,12,13)
