155815-95-5 Usage
General Description
4-Amino-1H-pyrrole-2-carboxylic acid, also known as 4-Aminoisatin, is a chemical compound with the molecular formula C5H5N3O2. It is a derivative of isatin, a naturally occurring compound found in some plants. This chemical is a yellow to orange colored solid that is insoluble in water and organic solvents. It is commonly used as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. Its properties and structure make it a valuable building block in the production of a wide range of chemical compounds. Additionally, 4-Amino-1H-pyrrole-2-carboxylic acid has potential applications in the field of medicinal chemistry due to its ability to interact with biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 155815-95-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,5,8,1 and 5 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 155815-95:
(8*1)+(7*5)+(6*5)+(5*8)+(4*1)+(3*5)+(2*9)+(1*5)=155
155 % 10 = 5
So 155815-95-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N2O2/c6-3-1-4(5(8)9)7-2-3/h1-2,7H,6H2,(H,8,9)
