155862-93-4 Usage
Chemical structure
The compound has a unique chemical structure that includes a pyridinium ring, an isothiocyanate group, and an oxazolyl ring.
Application
It is commonly used in the field of biochemistry and molecular biology as a fluorescent probe for studying protein structure and function, as well as in the investigation of cell biology and molecular interactions.
Water solubility
The tosylate salt form of the compound makes it water-soluble, allowing for easy handling and storage.
Stability
The tosylate salt form also contributes to the stability of the compound.
Versatility
The compound is versatile and plays a critical role in advancing our understanding of biological processes and mechanisms.
Fluorescent properties
The compound exhibits fluorescent properties, making it useful for various biological applications.
Molecular interactions
It is used to investigate molecular interactions, which is crucial in understanding the mechanisms of various biological processes.
Protein structure and function
The compound is used to study protein structure and function, which is essential for understanding the roles of proteins in biological systems.
Cell biology
It is also used in the investigation of cell biology, which helps in understanding the structure and function of cells and their components.
Biological applications
The compound is highly suitable for use in various biological applications due to its unique chemical structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 155862-93-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,5,8,6 and 2 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 155862-93:
(8*1)+(7*5)+(6*5)+(5*8)+(4*6)+(3*2)+(2*9)+(1*3)=164
164 % 10 = 4
So 155862-93-4 is a valid CAS Registry Number.
InChI:InChI=1/C24H20N3O3S.C7H8O3S/c1-28-21-6-2-18(3-7-21)23-16-25-24(30-23)19-10-12-27(13-11-19)14-15-29-22-8-4-20(5-9-22)26-17-31;1-6-2-4-7(5-3-6)11(8,9)10/h2-13,16H,14-15H2,1H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1