155879-96-2 Usage
Uses
Used in Pharmaceutical Industry:
1-(1-BUTYNYL)CYCLOPENTANOL is used as a building block for the synthesis of biologically active compounds, playing a pivotal role in the development of new drugs. Its unique structure allows for the creation of molecules with potential therapeutic properties, contributing to advancements in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 1-(1-BUTYNYL)CYCLOPENTANOL is utilized as a precursor for the synthesis of biologically active compounds with pesticidal properties. Its involvement in the production of pesticides highlights its potential to enhance crop protection and contribute to sustainable agriculture.
Used in Organic Synthesis:
1-(1-BUTYNYL)CYCLOPENTANOL is used as a starting material for the synthesis of various organic molecules. Its ability to participate in hydrogenation, oxidation, and substitution reactions makes it a valuable component in the creation of a wide array of chemical derivatives, expanding the scope of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 155879-96-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,5,8,7 and 9 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 155879-96:
(8*1)+(7*5)+(6*5)+(5*8)+(4*7)+(3*9)+(2*9)+(1*6)=192
192 % 10 = 2
So 155879-96-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H14O/c1-2-3-6-9(10)7-4-5-8-9/h10H,2,4-5,7-8H2,1H3
