155960-92-2 Usage
Uses
Used in Medicinal Chemistry:
4-Chloro-6-ethoxyquinazoline is utilized as a key intermediate in the synthesis of novel drugs and pharmaceuticals. Its unique chemical structure allows for the development of compounds with specific biological activities, contributing to the advancement of medicinal chemistry.
Used in Drug Discovery:
In the pharmaceutical industry, 4-chloro-6-ethoxyquinazoline serves as a valuable starting material for the design and synthesis of new drug candidates. Its versatile chemical properties enable the creation of molecules with potential therapeutic effects, addressing various medical conditions and diseases.
Used in Chemical Research:
4-Chloro-6-ethoxyquinazoline is employed as a subject of study in chemical research, where its synthesis, properties, and potential applications are explored. Researchers investigate its reactivity, stability, and interactions with other molecules to gain insights into its potential uses and optimize its synthesis methods.
Used in Industrial Applications:
Beyond the pharmaceutical sector, 4-chloro-6-ethoxyquinazoline may also find applications in other industries, such as materials science, where its unique properties can be harnessed for the development of new materials with specific characteristics. Its potential uses in various industrial applications are currently being explored by researchers and industry professionals.
Check Digit Verification of cas no
The CAS Registry Mumber 155960-92-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,5,9,6 and 0 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 155960-92:
(8*1)+(7*5)+(6*5)+(5*9)+(4*6)+(3*0)+(2*9)+(1*2)=162
162 % 10 = 2
So 155960-92-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN2O/c1-2-14-7-3-4-9-8(5-7)10(11)13-6-12-9/h3-6H,2H2,1H3
