155960-92-2 Usage
General Description
4-Chloro-6-ethoxyquinazoline is a chemical compound with the formula C9H8ClN3O. It is a quinazoline derivative, which is a class of heterocyclic compounds that have various pharmaceutical and industrial applications. The chemical features a chloro and ethoxy substituent on the quinazoline ring, imparting unique properties and reactivity to the molecule. 4-CHLORO-6-ETHOXY-QUINAZOLINE has potential applications in the field of medicinal chemistry, particularly in the development of novel drugs and pharmaceuticals. Its synthesis, properties, and potential biological activities make it a subject of interest for researchers in various scientific disciplines.
Check Digit Verification of cas no
The CAS Registry Mumber 155960-92-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,5,9,6 and 0 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 155960-92:
(8*1)+(7*5)+(6*5)+(5*9)+(4*6)+(3*0)+(2*9)+(1*2)=162
162 % 10 = 2
So 155960-92-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN2O/c1-2-14-7-3-4-9-8(5-7)10(11)13-6-12-9/h3-6H,2H2,1H3