155998-77-9 Usage
General Description
The complex chemical "4-[(E)-2-(2-CHLORO-3-((E)-2-[1-ETHYL-4(1H)-QUINOLINYLIDENE]ETHYLIDENE)-1-CYCLOHEXEN-1-YL)ETHENYL]-1-ETHYLQUINOLINIUM 4-METHYLBENZENESULFONATE" is a highly specific compound with a long and complex structure. It contains quinolinium and benzene groups, as well as chlorine and ethyl substituents. This chemical likely has a variety of potential applications in fields such as pharmaceuticals, agrochemicals, and materials science. Due to its complex structure and potential functionality, this compound requires careful analysis and testing to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 155998-77-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,5,9,9 and 8 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 155998-77:
(8*1)+(7*5)+(6*5)+(5*9)+(4*9)+(3*8)+(2*7)+(1*7)=199
199 % 10 = 9
So 155998-77-9 is a valid CAS Registry Number.
InChI:InChI=1/C32H32ClN2.C7H8O3S/c1-3-34-22-20-24(28-12-5-7-14-30(28)34)16-18-26-10-9-11-27(32(26)33)19-17-25-21-23-35(4-2)31-15-8-6-13-29(25)31;1-6-2-4-7(5-3-6)11(8,9)10/h5-8,12-23H,3-4,9-11H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1