156239-54-2 Usage
Uses
Used in Pharmaceutical Industry:
4-N-Decyloxybenzamide is used as a building block and intermediate for the production of various pharmaceuticals due to its potential biological activity. It plays a crucial role in the synthesis of new drug candidates with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, 4-N-Decyloxybenzamide is utilized as a key intermediate in the synthesis of agrochemicals, contributing to the development of effective and safe products for agricultural use.
Used in Materials Science:
4-N-Decyloxybenzamide is employed as a component in the development of new materials, leveraging its chemical properties to enhance material performance and create innovative solutions in various industries.
Used in Chemical Research:
As a chemical compound with unique properties, 4-N-Decyloxybenzamide is used in research to explore its potential applications and understand its interactions with other compounds, contributing to the advancement of scientific knowledge in the field of chemistry.
Used in Anticancer Applications:
4-N-Decyloxybenzamide has been studied for its anticancer properties, showing promise in the development of new therapeutic agents for the treatment of various types of cancer. Its potential biological activity makes it a valuable candidate for further research and development in oncology.
Used in Anti-inflammatory Applications:
The anti-inflammatory properties of 4-N-Decyloxybenzamide have also been investigated, with potential applications in the development of new treatments for inflammatory conditions. Its ability to modulate inflammatory processes could lead to the creation of effective medications for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 156239-54-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,6,2,3 and 9 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 156239-54:
(8*1)+(7*5)+(6*6)+(5*2)+(4*3)+(3*9)+(2*5)+(1*4)=142
142 % 10 = 2
So 156239-54-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H27NO2/c1-2-3-4-5-6-7-8-9-14-20-16-12-10-15(11-13-16)17(18)19/h10-13H,2-9,14H2,1H3,(H2,18,19)
