15632-20-9 Usage
General Description
Hematohemin IX is a complex heme molecule that plays a critical role in various biological processes, particularly in the transport and storage of oxygen in the body. It is a form of heme that is derived from the breakdown of hemoglobin, the oxygen-carrying protein in red blood cells. Hematohemin IX is composed of a porphyrin ring with an iron atom at its center, which is essential for its oxygen-binding capability. This molecule is involved in the regulation of oxygen levels in tissues and organs, as well as in the detoxification of harmful substances in the body. Hematohemin IX also serves as a cofactor for various enzymes, contributing to essential cellular functions such as energy production and metabolism. Overall, hematohemin IX plays a crucial role in maintaining the proper functioning of the human body and is a key component in the oxygen transport and metabolism pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 15632-20-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,6,3 and 2 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 15632-20:
(7*1)+(6*5)+(5*6)+(4*3)+(3*2)+(2*2)+(1*0)=89
89 % 10 = 9
So 15632-20-9 is a valid CAS Registry Number.
InChI:InChI=1/C34H38N4O6.ClH.Fe/c1-15-21(7-9-31(41)42)27-14-28-22(8-10-32(43)44)16(2)24(36-28)12-29-34(20(6)40)18(4)26(38-29)13-30-33(19(5)39)17(3)25(37-30)11-23(15)35-27;;/h11-14,19-20,39-40H,7-10H2,1-6H3,(H4,35,36,37,38,41,42,43,44);1H;/q;;+3/p-3/b23-11-,24-12-,25-11-,26-13-,27-14-,28-14-,29-12-,30-13-;;