156997-99-8 Usage
Uses
Used in Chemical Research:
N-[2-(2-BROMO-1H-INDOL-3-YL)ETHYL]ACETAMIDE is used as a research compound for exploring its potential biological activity and applications in specialized areas of chemical research. The presence of the bromine atom and the indole ring structure may contribute to its unique properties and interactions with other molecules, making it a valuable subject for investigation.
Check Digit Verification of cas no
The CAS Registry Mumber 156997-99-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,6,9,9 and 7 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 156997-99:
(8*1)+(7*5)+(6*6)+(5*9)+(4*9)+(3*7)+(2*9)+(1*9)=208
208 % 10 = 8
So 156997-99-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H13BrN2O/c1-8(16)14-7-6-10-9-4-2-3-5-11(9)15-12(10)13/h2-5,15H,6-7H2,1H3,(H,14,16)