15708-55-1 Usage
Description
2-[2-(carboxylatomethyl-(carboxymethyl)amino)ethyl-(carboxymethyl)amin o]acetate, nickel(+2) cation is a complex chemical compound that consists of a nickel cation with a positive charge of +2 and a carboxylate-containing ligand. 2-[2-(carboxylatomethyl-(carboxymethyl)amino)ethyl-(carboxymethyl)amin o]acetate, nickel(+2) cation is formed through a coordination complex where the nickel cation interacts with the carboxylate groups of the ligand. The ligand features multiple carboxylate groups, enabling it to bind to the metal cation through coordination bonds. Its complex structure and coordination properties make it a versatile and useful chemical in various applications.
Uses
Used in Catalyst Applications:
2-[2-(carboxylatomethyl-(carboxymethyl)amino)ethyl-(carboxymethyl)amin o]acetate, nickel(+2) cation is used as a catalyst in chemical reactions for its ability to facilitate and speed up the process, enhancing the efficiency and selectivity of the reactions.
Used in Chemical Compound Production:
In the chemical industry, 2-[2-(carboxylatomethyl-(carboxymethyl)amino)ethyl-(carboxymethyl)amin o]acetate, nickel(+2) cation is used as a component in the production of various chemical compounds, leveraging its coordination properties to create new and useful materials.
Used in Research Settings:
2-[2-(carboxylatomethyl-(carboxymethyl)amino)ethyl-(carboxymethyl)amin o]acetate, nickel(+2) cation is utilized in research for studying coordination chemistry, exploring its potential applications in catalysis, and understanding its interactions with other molecules and compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 15708-55-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,7,0 and 8 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 15708-55:
(7*1)+(6*5)+(5*7)+(4*0)+(3*8)+(2*5)+(1*5)=111
111 % 10 = 1
So 15708-55-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H16N2O8.Ni/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);/q;+2
