157284-07-6 Usage
Uses
Used in Organic Synthesis:
3-AMINO-7-HYDROXYBENZO[E][1,2,4]TRIAZINE 1-OXIDE is utilized as a key intermediate in organic synthesis, facilitating the creation of various complex organic molecules and contributing to the advancement of chemical research and development.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 3-AMINO-7-HYDROXYBENZO[E][1,2,4]TRIAZINE 1-OXIDE serves as a valuable building block for the design and synthesis of new pharmaceutical compounds, potentially leading to the discovery of innovative treatments and therapies.
Used in Pharmaceutical Industry:
3-AMINO-7-HYDROXYBENZO[E][1,2,4]TRIAZINE 1-OXIDE is used as a pharmaceutical intermediate, playing a crucial role in the production of various drugs and ensuring the efficiency and effectiveness of pharmaceutical manufacturing processes.
Used in Antiviral Applications:
3-AMINO-7-HYDROXYBENZO[E][1,2,4]TRIAZINE 1-OXIDE is studied for its potential as an antiviral agent, with the aim of developing new treatments to combat viral infections and contribute to public health.
Used in Anticancer Applications:
3-AMINO-7-HYDROXYBENZO[E][1,2,4]TRIAZINE 1-OXIDE is also being researched for its potential as an anticancer agent, with the goal of identifying new therapeutic approaches to treat cancer and improve patient outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 157284-07-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,7,2,8 and 4 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 157284-07:
(8*1)+(7*5)+(6*7)+(5*2)+(4*8)+(3*4)+(2*0)+(1*7)=146
146 % 10 = 6
So 157284-07-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N4O2/c8-7-9-5-2-1-4(12)3-6(5)11(13)10-7/h1-3,12H,(H2,8,9,10)
