157310-73-1 Usage
General Description
1-propenyl-2,3-diMethyliMidazoliuM hexafluorophosphate is a chemical compound that is commonly used as a sedative and anxiolytic agent in medical procedures. Its chemical structure consists of a propenyl group attached to a 2,3-diMethyliMidazolium core, which is further modified with a hexafluorophosphate salt. 1-propenyl-2,3-diMethyliMidazoliuM hexafluorophosphate is known for its ability to induce relaxation and reduce anxiety in patients undergoing surgical or diagnostic procedures. It works by binding to specific receptors in the brain and enhancing the activity of a neurotransmitter called gamma-aminobutyric acid (GABA), resulting in a calming effect. Due to its sedative properties, 1-propenyl-2,3-diMethyliMidazoliuM hexafluorophosphate is often administered under the supervision of medical professionals to ensure safe and appropriate usage.
Check Digit Verification of cas no
The CAS Registry Mumber 157310-73-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,7,3,1 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 157310-73:
(8*1)+(7*5)+(6*7)+(5*3)+(4*1)+(3*0)+(2*7)+(1*3)=121
121 % 10 = 1
So 157310-73-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H16N2.F6P/c1-4-5-10-7-6-9(3)8(10)2;1-7(2,3,4,5)6/h6-8H,4-5H2,1-3H3;/q;-1/p+1