157327-45-2 Usage
Uses
Used in Pharmaceutical Industry:
4,5,6,7-TETRAHYDRO-2-METHYL-2H-PYRAZOLO[4,3-C]PYRIDINE DIHYDROCHLORIDE is used as a potential pharmaceutical compound for its potential applications in the development of new drugs. Its specific properties and interactions with biological systems make it a promising candidate for medicinal chemistry research.
Used in Research and Development:
4,5,6,7-TETRAHYDRO-2-METHYL-2H-PYRAZOLO[4,3-C]PYRIDINE DIHYDROCHLORIDE is used as a research tool in the study of biological processes. Its unique structure and potential interactions with biological systems allow researchers to explore its applications and understand its effects on various biological pathways.
Check Digit Verification of cas no
The CAS Registry Mumber 157327-45-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,7,3,2 and 7 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 157327-45:
(8*1)+(7*5)+(6*7)+(5*3)+(4*2)+(3*7)+(2*4)+(1*5)=142
142 % 10 = 2
So 157327-45-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N3.2ClH/c1-10-5-6-4-8-3-2-7(6)9-10;;/h5,8H,2-4H2,1H3;2*1H
