157327-45-2 Usage
General Description
4,5,6,7-Tetrahydro-2-methyl-2H-pyrazolo[4,3-c]pyridine dihydrochloride is a chemical compound that belongs to the pyrazolopyridine class. It is a dihydrochloride salt of the pyrazolopyridine compound, which is known for its potential pharmaceutical applications. 4,5,6,7-TETRAHYDRO-2-METHYL-2H-PYRAZOLO[4,3-C]PYRIDINE DIHYDROCHLORIDE has a tetrahydro and methyl group attached to the pyrazolopyridine ring, making it a unique and potentially valuable molecule for medicinal chemistry research. Its dihydrochloride form makes it more stable and suitable for various pharmaceutical formulations. The compound's specific properties and potential uses depend on its interactions with biological systems, and it may have applications in the development of new drugs or as a research tool in the study of biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 157327-45-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,7,3,2 and 7 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 157327-45:
(8*1)+(7*5)+(6*7)+(5*3)+(4*2)+(3*7)+(2*4)+(1*5)=142
142 % 10 = 2
So 157327-45-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N3.2ClH/c1-10-5-6-4-8-3-2-7(6)9-10;;/h5,8H,2-4H2,1H3;2*1H
