15733-22-9 Usage
Uses
Used in Pharmaceutical Industry:
2-Chloro-5-hydroxytoluene sodium salt is used as a key intermediate for the synthesis of various pharmaceutical products. Its unique chemical structure allows it to participate in a range of organic synthesis reactions, contributing to the development of new and innovative medications.
Used in Agrochemical Industry:
In the agrochemical sector, 2-chloro-5-hydroxytoluene sodium salt serves as an essential component in the production of various agrochemicals. Its reactivity and stability make it suitable for use in the synthesis of compounds that can enhance crop protection and improve agricultural yields.
Used as a Reagent in Organic Synthesis Reactions:
2-Chloro-5-hydroxytoluene sodium salt is used as a reagent in organic synthesis reactions, where its chemical properties enable the formation of new compounds with desired characteristics. This makes it a valuable tool for researchers and chemists working on the development of novel chemical entities and materials.
Overall, 2-chloro-5-hydroxytoluene sodium salt is a versatile and essential compound in the fields of pharmaceuticals and agrochemicals, playing a crucial role in the synthesis and production of a wide range of products. Its applications extend beyond these industries, highlighting its importance in the broader context of chemical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 15733-22-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,7,3 and 3 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 15733-22:
(7*1)+(6*5)+(5*7)+(4*3)+(3*3)+(2*2)+(1*2)=99
99 % 10 = 9
So 15733-22-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H7ClO.Na/c1-5-4-6(9)2-3-7(5)8;/h2-4,9H,1H3;/q;+1/p-1
