157435-10-4 Usage
Uses
Used in Pharmaceutical Research:
2-(4-((7-CHLORO-2-QUINOXALINYL)OXY)-PHENOXY)-PROPIONIC ACID is used as a research compound for exploring its potential biological and pharmacological activities. Its unique structure allows scientists to investigate its interactions with biological systems and its effects on various biological processes.
Used in Drug Development:
In the pharmaceutical industry, 2-(4-((7-CHLORO-2-QUINOXALINYL)OXY)-PHENOXY)-PROPIONIC ACID is utilized as a lead compound in the development of new drugs. Its structural features can be modified to create derivatives with improved pharmacological properties, potentially leading to the discovery of novel therapeutic agents.
Used in Chemical Synthesis:
2-(4-((7-CHLORO-2-QUINOXALINYL)OXY)-PHENOXY)-PROPIONIC ACID can also be employed as a starting material or intermediate in the synthesis of other complex organic compounds. Its unique functional groups and structural elements make it a valuable component in the creation of new chemical entities with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 157435-10-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,7,4,3 and 5 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 157435-10:
(8*1)+(7*5)+(6*7)+(5*4)+(4*3)+(3*5)+(2*1)+(1*0)=134
134 % 10 = 4
So 157435-10-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H13ClN2O4/c1-10(17(21)22)23-12-3-5-13(6-4-12)24-16-9-19-14-7-2-11(18)8-15(14)20-16/h2-10H,1H3,(H,21,22)