157730-37-5 Usage
General Description
1-Methyl-1H-imidazo(4,5-b)(1,5)naphthyridin-2-amine is a chemical compound consisting of a fused ring system containing an imidazole and naphthyridine ring. It is a derivative of imidazo(4,5-b)pyridine and is classified as an amine due to the presence of an amino group. 1-Methyl-1H-imidazo(4,5-b)(1,5)naphthyridin-2-amine may have potential applications in pharmaceutical research and drug development due to its unique structural features and potential biological activities. However, further studies are needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 157730-37-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,7,7,3 and 0 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 157730-37:
(8*1)+(7*5)+(6*7)+(5*7)+(4*3)+(3*0)+(2*3)+(1*7)=145
145 % 10 = 5
So 157730-37-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H9N5/c1-15-8-5-7-6(3-2-4-12-7)13-9(8)14-10(15)11/h2-5H,1H3,(H2,11,13,14)