The given chemical formula represents a complex molecule consisting of a phosphorus-containing group, specifically a phosphonic acid derivative, and a phenyl-ammonium cation. The anionic part, CF3CF2CF2P(O)(OH)O^(1-), features a phosphorus atom bonded to three fluorinated carbon groups, a hydroxyl group, and an oxygen atom that carries a negative charge. The cationic part, C6H5NH3^(1+), is a phenyl-ammonium group with a positive charge. Together, they form an ionic compound where the negatively charged phosphonic acid derivative is balanced by the positively charged phenyl-ammonium group. CF3CF2CF2P(O)(OH)O(1-)*C6H5NH3(1+)=CF3CF2CF2P(O)(OH)O(C6H5NH3) likely has unique properties due to the combination of its fluorinated alkyl chains, phosphorus center, and aromatic amine group, which could be relevant in areas such as organophosphorus chemistry, pharmaceuticals, or materials science.
The CAS Registry Mumber 1579-97-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,7 and 9 respectively; the second part has 2 digits, 9 and 7 respectively. Calculate Digit Verification of CAS Registry Number 1579-97: (6*1)+(5*5)+(4*7)+(3*9)+(2*9)+(1*7)=111 111 % 10 = 1 So 1579-97-1 is a valid CAS Registry Number.