157915-07-6 Usage
Description
8-Nitroquinoline-6-carboxylic acid is a nitro-substituted quinoline derivative with the molecular formula C10H6N2O4. It is a significant intermediate in the synthesis of various pharmaceuticals and organic compounds, particularly in the production of antibacterial and antitumor drugs. 8-Nitroquinoline-6-carboxylic acid also serves as a fluorescent probe for detecting metal ions and is a precursor for the synthesis of fluorescent dyes and chelating agents. Furthermore, it has potential applications in material science for the development of luminescent materials and chemical sensors.
Uses
Used in Pharmaceutical Industry:
8-Nitroquinoline-6-carboxylic acid is used as an intermediate for the synthesis of various pharmaceuticals, specifically in the production of antibacterial and antitumor drugs. Its unique chemical structure allows for the development of effective medications targeting a wide range of diseases.
Used in Chemical Research:
As a fluorescent probe, 8-Nitroquinoline-6-carboxylic acid is utilized for detecting metal ions. This application is crucial in chemical research for understanding the interactions between metal ions and various chemical compounds.
Used in Material Science:
8-Nitroquinoline-6-carboxylic acid is used as a precursor for the synthesis of fluorescent dyes and chelating agents. Its role in material science is significant for the development of luminescent materials and chemical sensors, which have a wide range of applications in various industries.
Used in Environmental Monitoring:
8-Nitroquinoline-6-carboxylic acid's potential as a fluorescent probe also makes it useful in environmental monitoring. It can be employed to detect and measure the presence of metal ions in various environmental samples, contributing to pollution control and environmental protection efforts.
Check Digit Verification of cas no
The CAS Registry Mumber 157915-07-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,7,9,1 and 5 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 157915-07:
(8*1)+(7*5)+(6*7)+(5*9)+(4*1)+(3*5)+(2*0)+(1*7)=156
156 % 10 = 6
So 157915-07-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H6N2O4/c13-10(14)7-4-6-2-1-3-11-9(6)8(5-7)12(15)16/h1-5H,(H,13,14)
157915-07-6Relevant articles and documents
Carbapenem antibiotic compounds
-
, (2008/06/13)
The present invention relates to carbapenems and provides a compound of the formula (I) STR1 wherein: R1 is 1-hydroxyethyl, 1-fluoroethyl or hydroxymethyl; R2 is hydrogen or C1-4 alkyl; R3 is hydrogen or C1-4 alkyl; P1 is of the formula: STR2 and one or two of A,B,C,D,E,F,G and H, are nitrogen and the remainder are CH; and P is bonded to the nitrogen of the linking carbamoyl group by a carbon atom, in either ring, is substituted by the carboxy group on a carbon atom, in either ring, and is optionally further substituted, by up to three substitutents, on a carbon atom, in either ring; or a pharmaceutically acceptable salt or in vivo hydrolysable ester thereof. Processes for their preparation, intermediates in their preparation, their use as therapeutic agents and pharmaceutical compositions containing them are also described.
