158181-84-1 Usage
Uses
Used in Pharmaceutical Industry:
1-(5-Methyl-2-pyridinyl)-4-piperidinol is used as a synthetic intermediate for the production of pharmaceutical drugs. Its ability to modulate the activity of certain receptors in the central nervous system makes it a valuable component in the development of medications targeting neurological disorders and conditions.
Used in Agrochemical Industry:
In the agrochemical sector, 1-(5-Methyl-2-pyridinyl)-4-piperidinol is employed as a synthetic intermediate for the creation of agrochemicals. Its potential to interact with specific receptors can contribute to the development of more effective and targeted pest control solutions.
Used in Research and Development:
1-(5-Methyl-2-pyridinyl)-4-piperidinol is utilized as a building block in the synthesis of various organic compounds during research and development processes. Its unique structure allows scientists to explore new avenues in organic chemistry and potentially discover novel compounds with specific applications.
Used in Industrial Chemical Production:
1-(5-Methyl-2-pyridinyl)-4-piperidinol may have potential industrial applications as a precursor in the production of specialty chemicals. Its presence in the synthesis process can lead to the creation of unique and high-value chemical products for various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 158181-84-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,8,1,8 and 1 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 158181-84:
(8*1)+(7*5)+(6*8)+(5*1)+(4*8)+(3*1)+(2*8)+(1*4)=151
151 % 10 = 1
So 158181-84-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N2O/c1-9-2-3-11(12-8-9)13-6-4-10(14)5-7-13/h2-3,8,10,14H,4-7H2,1H3
158181-84-1Relevant academic research and scientific papers
NOVEL PYRROLOY2,3-d¨PYRIMIDINE COMPOUND
-
Page/Page column 61, (2011/12/12)
Disclosed is a novel pyrrolo[2,3-d]pyrimidine compound represented by formula [I] or a pharmacologically acceptable salt thereof, which has a GPR119 receptor agonistic activity and is useful for a pharmaceutical. In formula [I], E represents a group repre
