15821-36-0 Usage
General Description
6-(but-3-en-1-yl)-1,3,5-triazine-2,4-diamine, also known as 3-butene-1-yl-1,3,5-triazine-2,4-diamine, is a chemical compound with the molecular formula C7H10N6. It is a triazine derivative that contains an ethyl substituent on the 3-position and two amino groups on the 1 and 3 positions of the triazine ring. 6-(but-3-en-1-yl)-1,3,5-triazine-2,4-diamine is commonly used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. It has various applications in the chemical industry due to its unique structural and chemical properties, and it is known for its potential as a building block in the development of new compounds for various industrial uses.
Check Digit Verification of cas no
The CAS Registry Mumber 15821-36-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,8,2 and 1 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 15821-36:
(7*1)+(6*5)+(5*8)+(4*2)+(3*1)+(2*3)+(1*6)=100
100 % 10 = 0
So 15821-36-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H11N5/c1-2-3-4-5-10-6(8)12-7(9)11-5/h2H,1,3-4H2,(H4,8,9,10,11,12)