15828-63-4 Usage
Uses
Used in Pharmaceutical Industry:
5-Methyl-6-aminouracil is used as a pharmaceutical intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs with potential therapeutic benefits.
Used in Anticancer Drug Development:
In the field of oncology, 5-Methyl-6-aminouracil is utilized as a key component in the development of anticancer drugs. Its unique chemical structure allows it to interact with biological targets, potentially leading to the inhibition of cancer cell growth and proliferation.
Used in Antiviral Drug Development:
5-Methyl-6-aminouracil also plays a role in the development of antiviral drugs, where its properties can be harnessed to inhibit viral replication and reduce the spread of viral infections.
Used in Research and Development:
As a research chemical, 5-Methyl-6-aminouracil is employed in various scientific studies to explore its potential uses and understand its mechanisms of action. This research aids in the advancement of knowledge in the fields of chemistry, biology, and medicine.
Further research is being conducted to fully explore the potential uses of 5-Methyl-6-aminouracil, with the aim of discovering new applications and enhancing its therapeutic potential in various medical and pharmaceutical settings.
Check Digit Verification of cas no
The CAS Registry Mumber 15828-63-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,8,2 and 8 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 15828-63:
(7*1)+(6*5)+(5*8)+(4*2)+(3*8)+(2*6)+(1*3)=124
124 % 10 = 4
So 15828-63-4 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N3O2/c1-2-3(6)7-5(10)8-4(2)9/h1H3,(H4,6,7,8,9,10)
