15854-09-8 Usage
Properties
1. Molecular formula: C15H17NO2S
2. Ethyl ester derivative of 2-amino-4-(2,5-dimethyl-phenyl)-thiophene-3-carboxylic acid
3. Member of the thiophene family
4. Contains an amino group, a carboxylic acid group, and an ethyl ester group
Specific Content
1. Building block for the synthesis of various organic compounds in the pharmaceutical industry
2. Potential applications in drug development and medicinal chemistry
3. May have other industrial and research applications
Check Digit Verification of cas no
The CAS Registry Mumber 15854-09-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,8,5 and 4 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 15854-09:
(7*1)+(6*5)+(5*8)+(4*5)+(3*4)+(2*0)+(1*9)=118
118 % 10 = 8
So 15854-09-8 is a valid CAS Registry Number.
InChI:InChI=1/C15H17NO2S/c1-4-18-15(17)13-12(8-19-14(13)16)11-7-9(2)5-6-10(11)3/h5-8H,4,16H2,1-3H3