15862-38-1 Usage
Uses
Used in Pharmaceutical Industry:
3-Bromo-2-Hydrazino-5-Nitropyridine is used as an intermediate in the synthesis of pharmaceuticals for its potential role in the development of new drugs. Its presence in the molecular structure can contribute to the enhancement of pharmacological properties, such as improved efficacy and selectivity.
Used in Agrochemical Industry:
In the agrochemical sector, 3-Bromo-2-Hydrazino-5-Nitropyridine is utilized as an intermediate in the synthesis of agrochemicals, including pesticides and herbicides. Its incorporation into these compounds can lead to the creation of more effective and targeted agricultural products.
Used in Organic Compounds Synthesis:
3-Bromo-2-Hydrazino-5-Nitropyridine is employed as a key intermediate in the synthesis of other organic compounds, broadening its applications across various chemical domains. Its unique structural elements allow for the creation of a wide range of molecules with diverse functionalities.
Used in Material Development:
3-BROMO-2-HYDRAZINO-5-NITROPYRIDINE is also recognized for its potential use in the development of new materials, where its structural attributes can be leveraged to engineer materials with specific properties for various applications.
Used as a Reagent in Chemical Research:
3-Bromo-2-Hydrazino-5-Nitropyridine serves as a reagent in chemical research, facilitating the exploration of new chemical reactions and the synthesis of novel compounds. Its presence in research settings aids in advancing the understanding of chemical behavior and the discovery of new chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 15862-38-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,8,6 and 2 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 15862-38:
(7*1)+(6*5)+(5*8)+(4*6)+(3*2)+(2*3)+(1*8)=121
121 % 10 = 1
So 15862-38-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H5BrN4O2/c6-4-1-3(10(11)12)2-8-5(4)9-7/h1-2H,7H2,(H,8,9)
