158663-69-5 Usage
Description
(S)-Piperazine-2-carboxylic acid dihydrochloride is an organic compound that is a derivative of piperazine, featuring a carboxylic acid group at the 2-position. It is a chiral molecule, with the (S)-configuration indicating the spatial arrangement of its atoms. (S)-Piperazine-2-carboxylic acid dihydrochloride is often utilized in the synthesis of various pharmaceuticals and biologically active molecules due to its unique structural properties.
Uses
Used in Pharmaceutical Industry:
(S)-Piperazine-2-carboxylic acid dihydrochloride is used as a key intermediate for the synthesis of various pharmaceuticals and biologically active compounds. Its application is primarily due to its ability to be incorporated into complex molecular structures, contributing to the development of new drugs with specific therapeutic properties.
Used in Enzymatic Synthesis:
(S)-Piperazine-2-carboxylic acid dihydrochloride is used as a substrate in the preparation of optically pure (S)-piperazine-2-carboxylic acid, (R)-piperazine-2-carboxylic acid, and (S)-piperidine-2-carboxylic acid through kinetic resolution. This process involves the use of stereoselective amidases in whole bacterial cells, which selectively convert one enantiomer of the racemic carboxamides into the desired product, while the other enantiomer remains unreacted. This method is valuable for obtaining enantiomerically pure compounds, which are essential in the pharmaceutical industry to ensure the desired biological activity and minimize potential side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 158663-69-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,8,6,6 and 3 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 158663-69:
(8*1)+(7*5)+(6*8)+(5*6)+(4*6)+(3*3)+(2*6)+(1*9)=175
175 % 10 = 5
So 158663-69-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H10N2O2.2ClH/c8-5(9)4-3-6-1-2-7-4;;/h4,6-7H,1-3H2,(H,8,9);2*1H/t4-;;/m0../s1