159350-97-7 Usage
General Description
"(R)-(-)-2-(Methylmethoxy)-1,2-propanediol" is a chemical compound with the molecular formula C5H12O3. It is a chiral compound, meaning it has a non-superimposable mirror image, and specifically, it is the enantiomer of (S)-(+)-2-(methylmethoxy)-1,2-propanediol. (R)-(-)-2-(METHYLMETHOXY)-1,2-PROPANEDIOL is used in the synthesis of pharmaceuticals and other organic compounds. It can also be used as a chiral building block in organic synthesis and as a resolving agent for racemic mixtures of enantiomers. Additionally, it has been studied for its potential use in the production of chiral catalysts and pharmaceutical intermediates due to its asymmetric catalytic properties. Overall, (R)-(-)-2-(methylmethoxy)-1,2-propanediol has various potential applications in the pharmaceutical and chemical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 159350-97-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,9,3,5 and 0 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 159350-97:
(8*1)+(7*5)+(6*9)+(5*3)+(4*5)+(3*0)+(2*9)+(1*7)=157
157 % 10 = 7
So 159350-97-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H12O3/c1-5(3-6)8-4-7-2/h5-6H,3-4H2,1-2H3/t5-/m1/s1
159350-97-7Relevant articles and documents
PROCESS FOR THE PRODUCTION OF ALKANEDIOL DERIVATIVES
-
, (2008/06/13)
The present invention provides a process for producing an alkanediol derivative represented by the general formula (II) from an ester compound represented by the general formula (I), safely without giving rise to racemization. The present invention lies in a process for producing an alcohol derivative represented by the following general formula (II): (wherein R2 and R3 are each independently a hydrogen atom or an alkyl group having 1 to 4 carbon atoms; X is a hydrogen atom or a protecting group for hydroxyl group; and n is 0 or 1), which process comprises reducing an ester compound represented by the following general formula (I): (wherein R1 is an alkyl group having 1 to 4 carbon atoms; and R2, R3, X and n have the same definitions as given above) with sodium borohydride in a mixed solvent of at least one kind of solvent selected from the group consisting of aromatic hydrocarbons, aliphatic hydrocarbons and alicyclic hydrocarbons and a primary alcohol.