159350-97-7 Usage
Uses
Used in Pharmaceutical Industry:
(R)-(-)-2-(METHYLMETHOXY)-1,2-PROPANEDIOL is used as a chiral building block for the synthesis of pharmaceuticals and other organic compounds. Its unique stereochemistry allows for the creation of enantiomerically pure compounds, which is crucial for the development of drugs with specific therapeutic effects and reduced side effects.
Used in Chemical Industry:
In the chemical industry, (R)-(-)-2-(METHYLMETHOXY)-1,2-PROPANEDIOL serves as a resolving agent for racemic mixtures of enantiomers. This ability to separate enantiomers is essential for obtaining pure compounds with desired properties, which can be used in various chemical processes and applications.
Used in Catalyst Production:
(R)-(-)-2-(METHYLMETHOXY)-1,2-PROPANEDIOL has been studied for its potential use in the production of chiral catalysts. Its asymmetric catalytic properties make it a promising candidate for enhancing the selectivity and efficiency of chemical reactions, leading to the production of enantiomerically pure products.
Used in Pharmaceutical Intermediates:
(R)-(-)-2-(METHYLMETHOXY)-1,2-PROPANEDIOL is also utilized as a pharmaceutical intermediate, playing a crucial role in the synthesis of various drugs. Its presence in the intermediate stages of drug production allows for the development of new and innovative medications with improved therapeutic profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 159350-97-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,9,3,5 and 0 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 159350-97:
(8*1)+(7*5)+(6*9)+(5*3)+(4*5)+(3*0)+(2*9)+(1*7)=157
157 % 10 = 7
So 159350-97-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H12O3/c1-5(3-6)8-4-7-2/h5-6H,3-4H2,1-2H3/t5-/m1/s1
159350-97-7Relevant academic research and scientific papers
PROCESS FOR THE PRODUCTION OF ALKANEDIOL DERIVATIVES
-
, (2008/06/13)
The present invention provides a process for producing an alkanediol derivative represented by the general formula (II) from an ester compound represented by the general formula (I), safely without giving rise to racemization. The present invention lies in a process for producing an alcohol derivative represented by the following general formula (II): (wherein R2 and R3 are each independently a hydrogen atom or an alkyl group having 1 to 4 carbon atoms; X is a hydrogen atom or a protecting group for hydroxyl group; and n is 0 or 1), which process comprises reducing an ester compound represented by the following general formula (I): (wherein R1 is an alkyl group having 1 to 4 carbon atoms; and R2, R3, X and n have the same definitions as given above) with sodium borohydride in a mixed solvent of at least one kind of solvent selected from the group consisting of aromatic hydrocarbons, aliphatic hydrocarbons and alicyclic hydrocarbons and a primary alcohol.
Bryostatins: The asymmetric synthesis of the C1-C9 and C17-C27 fragments
De Brabander,Vandewalle
, p. 855 - 865 (2007/10/02)
The construction of the fragments C1-C9 3 and C17-C27 4a of the bryostatins in an enantioselective and highly diastereoselective fashion is described. The usefulness of the 'chiron' approach is illustrated with