159381-07-4 Usage
Uses
Used in Pharmaceutical Synthesis:
Thiomorpholine-3-carboxylic acid ethyl ester hydrochloride is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the formation of complex molecular structures that can exhibit therapeutic effects.
Used in Agrochemical Production:
In the agrochemical industry, Thiomorpholine-3-carboxylic acid ethyl ester hydrochloride is utilized as a precursor in the development of compounds that can enhance crop protection and yield, leveraging its reactivity and functional group versatility.
Used in Chemical Research:
As a building block in chemical synthesis, Thiomorpholine-3-carboxylic acid ethyl ester hydrochloride is employed in research settings to explore new chemical pathways and develop innovative molecules with potential applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 159381-07-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,9,3,8 and 1 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 159381-07:
(8*1)+(7*5)+(6*9)+(5*3)+(4*8)+(3*1)+(2*0)+(1*7)=154
154 % 10 = 4
So 159381-07-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H13NO2S.ClH/c1-2-10-7(9)6-5-11-4-3-8-6;/h6,8H,2-5H2,1H3;1H
