159631-29-5 Usage
Description
FMOC-SAR-OPFP is a chemical compound that serves as a versatile building block in organic synthesis and combinatorial chemistry. It is a derivative of fluorenylmethyloxycarbonyl (FMOC), commonly used as a protective group for amino acids in peptide synthesis. The acronym "SAR" in its name signifies its potential use in studying the structure-activity relationship, which is essential for understanding how the chemical structure of a compound influences its biological activity. The "OPFP" component of the name suggests the presence of a specific functional group or moiety, further enhancing its utility in various applications.
Uses
Used in Pharmaceutical Industry:
FMOC-SAR-OPFP is used as a building block for the construction of diverse chemical libraries, which are crucial for drug discovery. Its role in the synthesis of peptides and the study of structure-activity relationships makes it a valuable tool in the development of new pharmaceuticals with improved efficacy and selectivity.
Used in Organic Synthesis:
FMOC-SAR-OPFP is used as a reagent in organic synthesis, where its protective group properties allow for the selective protection and deprotection of amino acids during the synthesis of complex organic molecules. This selective protection is essential for the successful synthesis of target compounds with desired biological activities.
Used in Combinatorial Chemistry:
FMOC-SAR-OPFP is used as a key component in combinatorial chemistry, a technique that involves the rapid synthesis of large sets of related compounds to identify those with the most promising biological activities. Its versatility in forming diverse chemical libraries makes it an indispensable tool in the search for novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 159631-29-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,9,6,3 and 1 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 159631-29:
(8*1)+(7*5)+(6*9)+(5*6)+(4*3)+(3*1)+(2*2)+(1*9)=155
155 % 10 = 5
So 159631-29-5 is a valid CAS Registry Number.
InChI:InChI=1/C24H16F5NO4/c1-30(10-17(31)34-23-21(28)19(26)18(25)20(27)22(23)29)24(32)33-11-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,16H,10-11H2,1H3