159635-39-9 Usage
General Description
4-OXO-2-SPIRO(PIPERIDINE-4-YL)-BENZOPYRAN HYDROCHLORIDE is a chemical compound with a complex molecular structure. As suggested by its name, this compound contains an oxygen atom, a benzopyran group, a piperidine group and a hydrochloride group in its structure. The use or purpose of this specific chemical isn't entirely specified within common databases, which generally implies it is likely used as an intermediate step or a building block in creating a variety of compounds in pharmaceutical or chemical research. It is essential to handle such compounds following safety protocols to prevent any harmful exposure.
Check Digit Verification of cas no
The CAS Registry Mumber 159635-39-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,9,6,3 and 5 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 159635-39:
(8*1)+(7*5)+(6*9)+(5*6)+(4*3)+(3*5)+(2*3)+(1*9)=169
169 % 10 = 9
So 159635-39-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H15NO2.ClH/c15-11-9-13(5-7-14-8-6-13)16-12-4-2-1-3-10(11)12;/h1-4,14H,5-9H2;1H
