15965-33-0 Usage
Uses
Used in Pharmaceutical Industry:
4,5-Dichloro-2-methylimidazole is used as a key intermediate in the synthesis of anti-ulcer drugs, specifically for the production of famotidine. It plays a critical role in the development of medications that help treat and manage ulcers in the gastrointestinal tract.
Used in Organic Synthesis:
4,5-DICHLORO-2-METHYLIMIDAZOLE is also utilized in the synthesis of other organic compounds, contributing to the creation of a wide range of chemical products that have various applications across different industries.
Used as a Reagent in Organic Chemistry:
4,5-Dichloro-2-methylimidazole serves as a reagent in organic chemistry reactions, facilitating specific transformations and processes that are essential for the advancement of chemical research and the development of new chemical entities.
Check Digit Verification of cas no
The CAS Registry Mumber 15965-33-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,9,6 and 5 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 15965-33:
(7*1)+(6*5)+(5*9)+(4*6)+(3*5)+(2*3)+(1*3)=130
130 % 10 = 0
So 15965-33-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H4Cl2N2/c1-2-7-3(5)4(6)8-2/h1H3,(H,7,8)
