1598-64-7 Usage
Description
Uracil, 6-(fluoromethyl)(6CI,8CI) is a heterocyclic organic compound belonging to the uracil family. It is a derivative of uracil with a fluoromethyl group attached at the 6th position. Uracil, 6-(fluoromethyl)(6CI,8CI) has potential applications in medicinal chemistry and drug development due to its specific biological activities and pharmacological properties.
Uses
Used in Pharmaceutical Industry:
Uracil, 6-(fluoromethyl)(6CI,8CI) is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure and properties may contribute to the development of new drugs with improved therapeutic effects.
Used in Medicinal Chemistry Research:
Uracil, 6-(fluoromethyl)(6CI,8CI) serves as a valuable research tool in medicinal chemistry. It can be used to study the structure-activity relationships of uracil-based compounds and explore their potential as therapeutic agents.
Used in Drug Development:
The specific biological activities and pharmacological properties of Uracil, 6-(fluoromethyl)(6CI,8CI) make it a promising candidate for drug development. Further research and studies are needed to fully understand its potential uses and implications in treating various diseases and conditions.
Used in Agrochemicals:
Uracil, 6-(fluoromethyl)(6CI,8CI) may also have potential applications in the agrochemical industry. Its unique properties could be harnessed to develop new agrochemical products with improved efficacy and selectivity.
Used in Materials Science:
The potential applications of Uracil, 6-(fluoromethyl)(6CI,8CI) extend to materials science as well. Its unique structure and properties could be utilized in the development of new materials with specific characteristics for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1598-64-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,9 and 8 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1598-64:
(6*1)+(5*5)+(4*9)+(3*8)+(2*6)+(1*4)=107
107 % 10 = 7
So 1598-64-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H5FN2O2/c6-2-3-1-4(9)8-5(10)7-3/h1H,2H2,(H2,7,8,9,10)