160098-93-1 Usage
Description
Hamacanthine B is an optically active form of hamacanthin A with an S-configuration. It is an antifungal drug that has been isolated from the deep water marine sponge Hamacantha sp. Hamacanthine B exhibits potent antifungal properties, making it a valuable asset in the field of pharmaceuticals and medicine.
Uses
Used in Pharmaceutical Industry:
Hamacanthine B is used as an antifungal agent for its potent antifungal properties. It is particularly effective against various fungal infections, providing a valuable treatment option for patients suffering from such conditions. The compound's isolation from a deep water marine sponge adds to its uniqueness and potential for further research and development in the pharmaceutical sector.
Used in Antifungal Applications:
In the field of antifungal applications, Hamacanthine B serves as a crucial component in the development of new antifungal drugs. Its effectiveness against a wide range of fungal pathogens makes it a promising candidate for the treatment of various fungal infections, including those that are resistant to conventional antifungal medications.
Used in Research and Development:
Hamacanthine B also plays a significant role in research and development, particularly in the study of marine-derived compounds and their potential applications in medicine. The compound's unique structure and properties make it an interesting subject for further investigation, which could lead to the discovery of new antifungal drugs or other therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 160098-93-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,0,0,9 and 8 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 160098-93:
(8*1)+(7*6)+(6*0)+(5*0)+(4*9)+(3*8)+(2*9)+(1*3)=131
131 % 10 = 1
So 160098-93-1 is a valid CAS Registry Number.
InChI:InChI=1/C20H14Br2N4O/c21-10-1-3-12-14(7-23-16(12)5-10)18-9-25-20(27)19(26-18)15-8-24-17-6-11(22)2-4-13(15)17/h1-8,18,23-24H,9H2,(H,25,27)/t18-/m1/s1