160115-16-2 Usage
General Description
2-Acetamido-5-Chloro-6-Picoline is a chemical compound often used as an intermediate in organic synthesis and experiments. It is known for its ability to undergo various reactions to create new compounds. With a molecular formula of C8H8ClNO2, this chemical is notable for its inclusion of key elements such as carbon, hydrogen, chlorine, nitrogen, and oxygen. It's essential to handle and store this chemical properly to prevent any potential hazards or reactions. Since it is a specialty chemical, it is most commonly used in laboratory settings and is not usually found in everyday consumer products.
Check Digit Verification of cas no
The CAS Registry Mumber 160115-16-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,0,1,1 and 5 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 160115-16:
(8*1)+(7*6)+(6*0)+(5*1)+(4*1)+(3*5)+(2*1)+(1*6)=82
82 % 10 = 2
So 160115-16-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H9ClN2O/c1-5-7(9)3-4-8(10-5)11-6(2)12/h3-4H,1-2H3,(H,10,11,12)
