16015-48-8 Usage
General Description
3-ethyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid is a chemical compound with the molecular formula C11H11NO3. It is a derivative of phthalazine, containing an ethyl group and a carboxylic acid substituent. 3-ETHYL-4-OXO-3,4-DIHYDRO-PHTHALAZINE-1-CARBOXYLIC ACID has potential applications in pharmaceutical research and drug development due to its structural features and potential biological activities. Its properties and uses may include anti-inflammatory, antifungal, antibacterial, and antitumor activities. Further research is needed to fully understand the chemical and biological properties of 3-ethyl-4-oxo-3,4-dihydro-phthalazine-1-carboxylic acid.
Check Digit Verification of cas no
The CAS Registry Mumber 16015-48-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,0,1 and 5 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 16015-48:
(7*1)+(6*6)+(5*0)+(4*1)+(3*5)+(2*4)+(1*8)=78
78 % 10 = 8
So 16015-48-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O3/c1-2-13-10(14)8-6-4-3-5-7(8)9(12-13)11(15)16/h3-6H,2H2,1H3,(H,15,16)