16015-57-9 Usage
Uses
Used in Pharmaceutical Research and Development:
3-ETHYL-4-OXO-3,4-DIHYDRO-PHTHALAZINE-1-CARBOXYLIC ACID AMIDE is used as a potential drug candidate for its diverse biological activities and therapeutic potential. Its specific applications may vary depending on the research or industrial context, but it holds promise for the development of new medications to address various health conditions.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 3-ETHYL-4-OXO-3,4-DIHYDRO-PHTHALAZINE-1-CARBOXYLIC ACID AMIDE is utilized as a key intermediate in the synthesis of various pharmaceutical agents. Its unique structure and functional groups allow for the creation of novel compounds with potential therapeutic applications.
Used in Drug Discovery:
3-ETHYL-4-OXO-3,4-DIHYDRO-PHTHALAZINE-1-CARBOXYLIC ACID AMIDE is employed in drug discovery processes to identify new lead compounds with potential therapeutic effects. Its structural features and biological activity make it a valuable tool in the search for innovative treatments for a range of diseases and conditions.
Used in Biochemical Research:
In biochemical research, 3-ETHYL-4-OXO-3,4-DIHYDRO-PHTHALAZINE-1-CARBOXYLIC ACID AMIDE serves as a probe to study various biological processes and mechanisms. Its interaction with different biomolecules can provide insights into the underlying pathways and help in understanding the molecular basis of certain diseases.
Used in Chemical Synthesis:
3-ETHYL-4-OXO-3,4-DIHYDRO-PHTHALAZINE-1-CARBOXYLIC ACID AMIDE is used as a starting material or building block in the synthesis of complex organic compounds. Its versatile structure and functional groups enable the development of new chemical entities with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 16015-57-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,0,1 and 5 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 16015-57:
(7*1)+(6*6)+(5*0)+(4*1)+(3*5)+(2*5)+(1*7)=79
79 % 10 = 9
So 16015-57-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H11N3O2/c1-2-14-11(16)8-6-4-3-5-7(8)9(13-14)10(12)15/h3-6H,2H2,1H3,(H2,12,15)
